C18H24N2 — CID 54807006
N'-(2,3-dimethylphenyl)-N-(2-phenylethyl)ethane-1,2-diamine (PubChem CID 54807006) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N'-(2,3-dimethylphenyl)-N-(2-phenylethyl)ethane-1,2-diamine.
| Compound Name | N'-(2,3-dimethylphenyl)-N-(2-phenylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54807006 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N'-(2,3-dimethylphenyl)-N-(2-phenylethyl)ethane-1,2-diamine |
| SMILES | Cc1cccc(NCCNCCc2ccccc2)c1C |
| InChI | InChI=1S/C18H24N2/c1-15-7-6-10-18(16(15)2)20-14-13-19-12-11-17-8-4-3-5-9-17/h3-10,19-20H,11-14H2,1-2H3 |
| InChIKey | BUHBAIAMWHZCAH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|