C18H23NO2 — CID 175448532
N-benzyl-2,3-dimethylaniline;propanoic acid (PubChem CID 175448532) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-benzyl-2,3-dimethylaniline;propanoic acid.
| Compound Name | N-benzyl-2,3-dimethylaniline;propanoic acid |
|---|---|
| PubChem CID | 175448532 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-benzyl-2,3-dimethylaniline;propanoic acid |
| SMILES | CCC(=O)O.Cc1cccc(NCc2ccccc2)c1C |
| InChI | InChI=1S/C15H17N.C3H6O2/c1-12-7-6-10-15(13(12)2)16-11-14-8-4-3-5-9-14;1-2-3(4)5/h3-10,16H,11H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | XKABKSWHNAARIU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |