About N-benzyl-2-methylaniline;propanoic acid
N-benzyl-2-methylaniline;propanoic acid (PubChem CID 175171674) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is N-benzyl-2-methylaniline;propanoic acid.
Molecular Properties
| Compound Name | N-benzyl-2-methylaniline;propanoic acid |
| PubChem CID | 175171674 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N-benzyl-2-methylaniline;propanoic acid |
| SMILES | CCC(=O)O.Cc1ccccc1NCc1ccccc1 |
| InChI | InChI=1S/C14H15N.C3H6O2/c1-12-7-5-6-10-14(12)15-11-13-8-3-2-4-9-13;1-2-3(4)5/h2-10,15H,11H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | SREIXMAOWABAEH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-2-methylaniline;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-methylaniline;propanoic acid?
The IUPAC name of N-benzyl-2-methylaniline;propanoic acid (CID 175171674) is N-benzyl-2-methylaniline;propanoic acid.
What is the SMILES notation for N-benzyl-2-methylaniline;propanoic acid?
The canonical SMILES for N-benzyl-2-methylaniline;propanoic acid is CCC(=O)O.Cc1ccccc1NCc1ccccc1.
What is the InChIKey of N-benzyl-2-methylaniline;propanoic acid?
The InChIKey is SREIXMAOWABAEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.C3H6O2/c1-12-7-5-6-10-14(12)15-11-13-8-3-2-4-9-13;1-2-3(4)5/h2-10,15H,11H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of N-benzyl-2-methylaniline;propanoic acid?
N-benzyl-2-methylaniline;propanoic acid has a molecular weight of 271.36 g/mol, XLogP of 4.09, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-methylaniline;propanoic acid is sourced from PubChem (CID 175171674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).