C16H20N2 — CID 174482697
1-N-benzyl-2-N-ethyl-3-methylbenzene-1,2-diamine (PubChem CID 174482697) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-N-benzyl-2-N-ethyl-3-methylbenzene-1,2-diamine.
| Compound Name | 1-N-benzyl-2-N-ethyl-3-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 174482697 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-N-benzyl-2-N-ethyl-3-methylbenzene-1,2-diamine |
| SMILES | CCNc1c(C)cccc1NCc1ccccc1 |
| InChI | InChI=1S/C16H20N2/c1-3-17-16-13(2)8-7-11-15(16)18-12-14-9-5-4-6-10-14/h4-11,17-18H,3,12H2,1-2H3 |
| InChIKey | TWHMZKPXLFZURE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |