C18H25NSi — CID 103437518
2,3-dimethyl-N-[(4-trimethylsilylphenyl)methyl]aniline (PubChem CID 103437518) has the molecular formula C18H25NSi and a molecular weight of 283.49 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(4-trimethylsilylphenyl)methyl]aniline.
| Compound Name | 2,3-dimethyl-N-[(4-trimethylsilylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 103437518 |
| Molecular Formula | C18H25NSi |
| Molecular Weight | 283.49 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2,3-dimethyl-N-[(4-trimethylsilylphenyl)methyl]aniline |
| SMILES | Cc1cccc(NCc2ccc([Si](C)(C)C)cc2)c1C |
| InChI | InChI=1S/C18H25NSi/c1-14-7-6-8-18(15(14)2)19-13-16-9-11-17(12-10-16)20(3,4)5/h6-12,19H,13H2,1-5H3 |
| InChIKey | CABBQGUMWZVKMV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|