C16H19Cl2NSi — CID 103437879
2,6-dichloro-N-[(4-trimethylsilylphenyl)methyl]aniline (PubChem CID 103437879) has the molecular formula C16H19Cl2NSi and a molecular weight of 324.33 g/mol. Its IUPAC name is 2,6-dichloro-N-[(4-trimethylsilylphenyl)methyl]aniline.
| Compound Name | 2,6-dichloro-N-[(4-trimethylsilylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 103437879 |
| Molecular Formula | C16H19Cl2NSi |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2,6-dichloro-N-[(4-trimethylsilylphenyl)methyl]aniline |
| SMILES | C[Si](C)(C)c1ccc(CNc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H19Cl2NSi/c1-20(2,3)13-9-7-12(8-10-13)11-19-16-14(17)5-4-6-15(16)18/h4-10,19H,11H2,1-3H3 |
| InChIKey | ZMQCMWSRIUHHHT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|