C15H27N — CID 142146831
ethane;N-ethyl-2,6-dimethylaniline;prop-1-ene (PubChem CID 142146831) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;N-ethyl-2,6-dimethylaniline;prop-1-ene.
| Compound Name | ethane;N-ethyl-2,6-dimethylaniline;prop-1-ene |
|---|---|
| PubChem CID | 142146831 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;N-ethyl-2,6-dimethylaniline;prop-1-ene |
| SMILES | C=CC.CC.CCNc1c(C)cccc1C |
| InChI | InChI=1S/C10H15N.C3H6.C2H6/c1-4-11-10-8(2)6-5-7-9(10)3;1-3-2;1-2/h5-7,11H,4H2,1-3H3;3H,1H2,2H3;1-2H3 |
| InChIKey | DGWDORYWNDJEGX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|