C13H21N — CID 142207467
2,6-dimethyl-N-[(E)-prop-1-enyl]aniline;ethane (PubChem CID 142207467) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(E)-prop-1-enyl]aniline;ethane.
| Compound Name | 2,6-dimethyl-N-[(E)-prop-1-enyl]aniline;ethane |
|---|---|
| PubChem CID | 142207467 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2,6-dimethyl-N-[(E)-prop-1-enyl]aniline;ethane |
| SMILES | C/C=C/Nc1c(C)cccc1C.CC |
| InChI | InChI=1S/C11H15N.C2H6/c1-4-8-12-11-9(2)6-5-7-10(11)3;1-2/h4-8,12H,1-3H3;1-2H3/b8-4+; |
| InChIKey | GTFJNBNMSRZWKY-ZFXMFRGYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |