C12H15N — CID 156821299
2-methyl-N-[(1E,3E)-penta-1,3-dienyl]aniline (PubChem CID 156821299) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-methyl-N-[(1E,3E)-penta-1,3-dienyl]aniline.
| Compound Name | 2-methyl-N-[(1E,3E)-penta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 156821299 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-methyl-N-[(1E,3E)-penta-1,3-dienyl]aniline |
| SMILES | C/C=C/C=C/Nc1ccccc1C |
| InChI | InChI=1S/C12H15N/c1-3-4-7-10-13-12-9-6-5-8-11(12)2/h3-10,13H,1-2H3/b4-3+,10-7+ |
| InChIKey | BBOJYVIIFUMDBE-YZQQHVNFSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|