C16H14N2S — CID 158212978
N-[2-(1,3-benzothiazol-2-yl)ethenyl]-2-methylaniline (PubChem CID 158212978) has the molecular formula C16H14N2S and a molecular weight of 266.37 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethenyl]-2-methylaniline.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethenyl]-2-methylaniline |
|---|---|
| PubChem CID | 158212978 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethenyl]-2-methylaniline |
| SMILES | Cc1ccccc1NC=Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14N2S/c1-12-6-2-3-7-13(12)17-11-10-16-18-14-8-4-5-9-15(14)19-16/h2-11,17H,1H3 |
| InChIKey | GCHLFVPHJOWIGB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |