C14H27NO — CID 143317223
acetaldehyde;N,2-dimethylaniline;ethane (PubChem CID 143317223) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is acetaldehyde;N,2-dimethylaniline;ethane.
| Compound Name | acetaldehyde;N,2-dimethylaniline;ethane |
|---|---|
| PubChem CID | 143317223 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | acetaldehyde;N,2-dimethylaniline;ethane |
| SMILES | CC.CC.CC=O.CNc1ccccc1C |
| InChI | InChI=1S/C8H11N.C2H4O.2C2H6/c1-7-5-3-4-6-8(7)9-2;1-2-3;2*1-2/h3-6,9H,1-2H3;2H,1H3;2*1-2H3 |
| InChIKey | ZSZUOJSDTPXZRS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|