C9H13NO — CID 142628906
N-methoxy-2,6-dimethylaniline (PubChem CID 142628906) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is N-methoxy-2,6-dimethylaniline.
| Compound Name | N-methoxy-2,6-dimethylaniline |
|---|---|
| PubChem CID | 142628906 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-methoxy-2,6-dimethylaniline |
| SMILES | CONc1c(C)cccc1C |
| InChI | InChI=1S/C9H13NO/c1-7-5-4-6-8(2)9(7)10-11-3/h4-6,10H,1-3H3 |
| InChIKey | ZANPGJRHZLTAOT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|