C24H28N2O2 — CID 86003268
1-N,2-N-bis(2,6-dimethylphenyl)-4,5-dimethoxybenzene-1,2-diamine (PubChem CID 86003268) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-N,2-N-bis(2,6-dimethylphenyl)-4,5-dimethoxybenzene-1,2-diamine.
| Compound Name | 1-N,2-N-bis(2,6-dimethylphenyl)-4,5-dimethoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 86003268 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-N,2-N-bis(2,6-dimethylphenyl)-4,5-dimethoxybenzene-1,2-diamine |
| SMILES | COc1cc(Nc2c(C)cccc2C)c(Nc2c(C)cccc2C)cc1OC |
| InChI | InChI=1S/C24H28N2O2/c1-15-9-7-10-16(2)23(15)25-19-13-21(27-5)22(28-6)14-20(19)26-24-17(3)11-8-12-18(24)4/h7-14,25-26H,1-6H3 |
| InChIKey | YBRYOHQOQAAUDP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |