C16H18N2O2S — CID 107107680
2-(2,4-dimethoxyanilino)-3-methylbenzenecarbothioamide (PubChem CID 107107680) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(2,4-dimethoxyanilino)-3-methylbenzenecarbothioamide.
| Compound Name | 2-(2,4-dimethoxyanilino)-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107107680 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(2,4-dimethoxyanilino)-3-methylbenzenecarbothioamide |
| SMILES | COc1ccc(Nc2c(C)cccc2C(N)=S)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O2S/c1-10-5-4-6-12(16(17)21)15(10)18-13-8-7-11(19-2)9-14(13)20-3/h4-9,18H,1-3H3,(H2,17,21) |
| InChIKey | OQOLMZHDSAFCGG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|