C15H14FNO4 — CID 62648655
2-(2,4-dimethoxyanilino)-3-fluorobenzoic acid (PubChem CID 62648655) has the molecular formula C15H14FNO4 and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-(2,4-dimethoxyanilino)-3-fluorobenzoic acid.
| Compound Name | 2-(2,4-dimethoxyanilino)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 62648655 |
| Molecular Formula | C15H14FNO4 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-(2,4-dimethoxyanilino)-3-fluorobenzoic acid |
| SMILES | COc1ccc(Nc2c(F)cccc2C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C15H14FNO4/c1-20-9-6-7-12(13(8-9)21-2)17-14-10(15(18)19)4-3-5-11(14)16/h3-8,17H,1-2H3,(H,18,19) |
| InChIKey | DGBGOERSTVHEQY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |