C16H20N2O — CID 115125930
2-N-(4-methoxy-2,5-dimethylphenyl)-3-methylbenzene-1,2-diamine (PubChem CID 115125930) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-N-(4-methoxy-2,5-dimethylphenyl)-3-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(4-methoxy-2,5-dimethylphenyl)-3-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115125930 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-N-(4-methoxy-2,5-dimethylphenyl)-3-methylbenzene-1,2-diamine |
| SMILES | COc1cc(C)c(Nc2c(C)cccc2N)cc1C |
| InChI | InChI=1S/C16H20N2O/c1-10-6-5-7-13(17)16(10)18-14-8-12(3)15(19-4)9-11(14)2/h5-9,18H,17H2,1-4H3 |
| InChIKey | BICCSZWAQQZTSP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|