C15H16ClN — CID 57056849
N-(4-chloro-2-methylphenyl)-2,6-dimethylaniline (PubChem CID 57056849) has the molecular formula C15H16ClN and a molecular weight of 245.75 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2,6-dimethylaniline.
| Compound Name | N-(4-chloro-2-methylphenyl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 57056849 |
| Molecular Formula | C15H16ClN |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(Cl)ccc1Nc1c(C)cccc1C |
| InChI | InChI=1S/C15H16ClN/c1-10-5-4-6-11(2)15(10)17-14-8-7-13(16)9-12(14)3/h4-9,17H,1-3H3 |
| InChIKey | YBFWPPNWCMPAKH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |