C17H15ClN2 — CID 134151417
7-chloro-N-(2,6-dimethylphenyl)quinolin-4-amine (PubChem CID 134151417) has the molecular formula C17H15ClN2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 7-chloro-N-(2,6-dimethylphenyl)quinolin-4-amine.
| Compound Name | 7-chloro-N-(2,6-dimethylphenyl)quinolin-4-amine |
|---|---|
| PubChem CID | 134151417 |
| Molecular Formula | C17H15ClN2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 7-chloro-N-(2,6-dimethylphenyl)quinolin-4-amine |
| SMILES | Cc1cccc(C)c1Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H15ClN2/c1-11-4-3-5-12(2)17(11)20-15-8-9-19-16-10-13(18)6-7-14(15)16/h3-10H,1-2H3,(H,19,20) |
| InChIKey | MGFKREQRHPUEAB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |