C17H21ClN2 — CID 54809835
N-(5-chloro-2-methylphenyl)-N'-(2,6-dimethylphenyl)ethane-1,2-diamine (PubChem CID 54809835) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N'-(2,6-dimethylphenyl)ethane-1,2-diamine.
| Compound Name | N-(5-chloro-2-methylphenyl)-N'-(2,6-dimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809835 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N'-(2,6-dimethylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccc(Cl)cc1NCCNc1c(C)cccc1C |
| InChI | InChI=1S/C17H21ClN2/c1-12-7-8-15(18)11-16(12)19-9-10-20-17-13(2)5-4-6-14(17)3/h4-8,11,19-20H,9-10H2,1-3H3 |
| InChIKey | WGGAARZTTYBJQY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|