C16H15ClF2N2O — CID 109038491
3-(5-chloro-2-methylanilino)-N-(2,6-difluorophenyl)propanamide (PubChem CID 109038491) has the molecular formula C16H15ClF2N2O and a molecular weight of 324.76 g/mol. Its IUPAC name is 3-(5-chloro-2-methylanilino)-N-(2,6-difluorophenyl)propanamide.
| Compound Name | 3-(5-chloro-2-methylanilino)-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 109038491 |
| Molecular Formula | C16H15ClF2N2O |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3-(5-chloro-2-methylanilino)-N-(2,6-difluorophenyl)propanamide |
| SMILES | Cc1ccc(Cl)cc1NCCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C16H15ClF2N2O/c1-10-5-6-11(17)9-14(10)20-8-7-15(22)21-16-12(18)3-2-4-13(16)19/h2-6,9,20H,7-8H2,1H3,(H,21,22) |
| InChIKey | WQWFWWLHMGXGQC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |