C15H12Cl2F2N2O — CID 109042717
3-(2,6-dichloroanilino)-N-(2,6-difluorophenyl)propanamide (PubChem CID 109042717) has the molecular formula C15H12Cl2F2N2O and a molecular weight of 345.18 g/mol. Its IUPAC name is 3-(2,6-dichloroanilino)-N-(2,6-difluorophenyl)propanamide.
| Compound Name | 3-(2,6-dichloroanilino)-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 109042717 |
| Molecular Formula | C15H12Cl2F2N2O |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 3-(2,6-dichloroanilino)-N-(2,6-difluorophenyl)propanamide |
| SMILES | O=C(CCNc1c(Cl)cccc1Cl)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H12Cl2F2N2O/c16-9-3-1-4-10(17)14(9)20-8-7-13(22)21-15-11(18)5-2-6-12(15)19/h1-6,20H,7-8H2,(H,21,22) |
| InChIKey | WJCFZTOJLGSLHP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |