C19H22F2N2O — CID 109037146
3-(2,6-diethylanilino)-N-(2,6-difluorophenyl)propanamide (PubChem CID 109037146) has the molecular formula C19H22F2N2O and a molecular weight of 332.39 g/mol. Its IUPAC name is 3-(2,6-diethylanilino)-N-(2,6-difluorophenyl)propanamide.
| Compound Name | 3-(2,6-diethylanilino)-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 109037146 |
| Molecular Formula | C19H22F2N2O |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-(2,6-diethylanilino)-N-(2,6-difluorophenyl)propanamide |
| SMILES | CCc1cccc(CC)c1NCCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C19H22F2N2O/c1-3-13-7-5-8-14(4-2)18(13)22-12-11-17(24)23-19-15(20)9-6-10-16(19)21/h5-10,22H,3-4,11-12H2,1-2H3,(H,23,24) |
| InChIKey | MJLWIHJMYQVIFC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |