C20H36N2 — CID 156886237
N'-[3-methyl-2-(2-methylbutyl)phenyl]octane-1,8-diamine (PubChem CID 156886237) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is N'-[3-methyl-2-(2-methylbutyl)phenyl]octane-1,8-diamine.
| Compound Name | N'-[3-methyl-2-(2-methylbutyl)phenyl]octane-1,8-diamine |
|---|---|
| PubChem CID | 156886237 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | N'-[3-methyl-2-(2-methylbutyl)phenyl]octane-1,8-diamine |
| SMILES | CCC(C)Cc1c(C)cccc1NCCCCCCCCN |
| InChI | InChI=1S/C20H36N2/c1-4-17(2)16-19-18(3)12-11-13-20(19)22-15-10-8-6-5-7-9-14-21/h11-13,17,22H,4-10,14-16,21H2,1-3H3 |
| InChIKey | PPPLKKPRJOGKNJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|