C17H16N8O12 — CID 23496475
N,N'-bis(2,3,4-trinitrophenyl)pentane-1,5-diamine (PubChem CID 23496475) has the molecular formula C17H16N8O12 and a molecular weight of 524.36 g/mol. Its IUPAC name is N,N'-bis(2,3,4-trinitrophenyl)pentane-1,5-diamine.
| Compound Name | N,N'-bis(2,3,4-trinitrophenyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 23496475 |
| Molecular Formula | C17H16N8O12 |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | N,N'-bis(2,3,4-trinitrophenyl)pentane-1,5-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCCCCNc2ccc([N+](=O)[O-])c([N+](=O)[O-])c2[N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N8O12/c26-20(27)12-6-4-10(14(22(30)31)16(12)24(34)35)18-8-2-1-3-9-19-11-5-7-13(21(28)29)17(25(36)37)15(11)23(32)33/h4-7,18-19H,1-3,8-9H2 |
| InChIKey | BUZBITCLQNSAOB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 282.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|