C18H24N4O4 — CID 25215086
2-N,6-N-dibutyl-1,5-dinitronaphthalene-2,6-diamine (PubChem CID 25215086) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-N,6-N-dibutyl-1,5-dinitronaphthalene-2,6-diamine.
| Compound Name | 2-N,6-N-dibutyl-1,5-dinitronaphthalene-2,6-diamine |
|---|---|
| PubChem CID | 25215086 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-N,6-N-dibutyl-1,5-dinitronaphthalene-2,6-diamine |
| SMILES | CCCCNc1ccc2c([N+](=O)[O-])c(NCCCC)ccc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N4O4/c1-3-5-11-19-15-9-7-14-13(17(15)21(23)24)8-10-16(18(14)22(25)26)20-12-6-4-2/h7-10,19-20H,3-6,11-12H2,1-2H3 |
| InChIKey | VKOAPZMJASNBRT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|