C17H20N2O4S — CID 68853978
3-(benzenesulfonyl)-2-nitro-N-pentylaniline (PubChem CID 68853978) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-nitro-N-pentylaniline.
| Compound Name | 3-(benzenesulfonyl)-2-nitro-N-pentylaniline |
|---|---|
| PubChem CID | 68853978 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3-(benzenesulfonyl)-2-nitro-N-pentylaniline |
| SMILES | CCCCCNc1cccc(S(=O)(=O)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N2O4S/c1-2-3-7-13-18-15-11-8-12-16(17(15)19(20)21)24(22,23)14-9-5-4-6-10-14/h4-6,8-12,18H,2-3,7,13H2,1H3 |
| InChIKey | PNFZGWBFVPDCHV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|