C12H19N3O4S — CID 80791907
3-N-(2-methylsulfonylethyl)-2-nitro-1-N-propylbenzene-1,3-diamine (PubChem CID 80791907) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-N-(2-methylsulfonylethyl)-2-nitro-1-N-propylbenzene-1,3-diamine.
| Compound Name | 3-N-(2-methylsulfonylethyl)-2-nitro-1-N-propylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 80791907 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-N-(2-methylsulfonylethyl)-2-nitro-1-N-propylbenzene-1,3-diamine |
| SMILES | CCCNc1cccc(NCCS(C)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N3O4S/c1-3-7-13-10-5-4-6-11(12(10)15(16)17)14-8-9-20(2,18)19/h4-6,13-14H,3,7-9H2,1-2H3 |
| InChIKey | RLEANCNEOBBUED-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|