C9H14N4O4S — CID 80788563
2-[3-(methylamino)-2-nitroanilino]ethanesulfonamide (PubChem CID 80788563) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-[3-(methylamino)-2-nitroanilino]ethanesulfonamide.
| Compound Name | 2-[3-(methylamino)-2-nitroanilino]ethanesulfonamide |
|---|---|
| PubChem CID | 80788563 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[3-(methylamino)-2-nitroanilino]ethanesulfonamide |
| SMILES | CNc1cccc(NCCS(N)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H14N4O4S/c1-11-7-3-2-4-8(9(7)13(14)15)12-5-6-18(10,16)17/h2-4,11-12H,5-6H2,1H3,(H2,10,16,17) |
| InChIKey | GSYLWVDHJLHODA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|