C13H10N4O2S — CID 15574322
N-benzyl-4-nitro-2,1,3-benzothiadiazol-5-amine (PubChem CID 15574322) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is N-benzyl-4-nitro-2,1,3-benzothiadiazol-5-amine.
| Compound Name | N-benzyl-4-nitro-2,1,3-benzothiadiazol-5-amine |
|---|---|
| PubChem CID | 15574322 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-benzyl-4-nitro-2,1,3-benzothiadiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccccc2)ccc2nsnc12 |
| InChI | InChI=1S/C13H10N4O2S/c18-17(19)13-11(7-6-10-12(13)16-20-15-10)14-8-9-4-2-1-3-5-9/h1-7,14H,8H2 |
| InChIKey | SGNZKZAAIWQPJN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|