C12H9Br2N3O2 — CID 87304636
N-benzyl-2,6-dibromo-3-nitropyridin-4-amine (PubChem CID 87304636) has the molecular formula C12H9Br2N3O2 and a molecular weight of 387.03 g/mol. Its IUPAC name is N-benzyl-2,6-dibromo-3-nitropyridin-4-amine.
| Compound Name | N-benzyl-2,6-dibromo-3-nitropyridin-4-amine |
|---|---|
| PubChem CID | 87304636 |
| Molecular Formula | C12H9Br2N3O2 |
| Molecular Weight | 387.03 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | N-benzyl-2,6-dibromo-3-nitropyridin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCc2ccccc2)cc(Br)nc1Br |
| InChI | InChI=1S/C12H9Br2N3O2/c13-10-6-9(11(17(18)19)12(14)16-10)15-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,15,16) |
| InChIKey | QONDDYZKZJSFPL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.03 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|