C12H18N5O2S+ — CID 7207907
diethyl-[2-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]ethyl]azanium (PubChem CID 7207907) has the molecular formula C12H18N5O2S+ and a molecular weight of 296.38 g/mol. Its IUPAC name is diethyl-[2-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]ethyl]azanium.
| Compound Name | diethyl-[2-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7207907 |
| Molecular Formula | C12H18N5O2S+ |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | diethyl-[2-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]ethyl]azanium |
| SMILES | CC[NH+](CC)CCNc1ccc2nsnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N5O2S/c1-3-16(4-2)8-7-13-10-6-5-9-11(15-20-14-9)12(10)17(18)19/h5-6,13H,3-4,7-8H2,1-2H3/p+1 |
| InChIKey | HSGHJVTYQZAALK-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|