C12H18ClN4O4+ — CID 7201275
2-(4-chloro-2,6-dinitroanilino)ethyl-diethylazanium (PubChem CID 7201275) has the molecular formula C12H18ClN4O4+ and a molecular weight of 317.75 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dinitroanilino)ethyl-diethylazanium.
| Compound Name | 2-(4-chloro-2,6-dinitroanilino)ethyl-diethylazanium |
|---|---|
| PubChem CID | 7201275 |
| Molecular Formula | C12H18ClN4O4+ |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-(4-chloro-2,6-dinitroanilino)ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCNc1c([N+](=O)[O-])cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17ClN4O4/c1-3-15(4-2)6-5-14-12-10(16(18)19)7-9(13)8-11(12)17(20)21/h7-8,14H,3-6H2,1-2H3/p+1 |
| InChIKey | MMMNHKQXMQPHPZ-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|