C9H7N7O12 — CID 71366056
2,4,6-trinitro-N-(3,3,3-trinitropropyl)aniline (PubChem CID 71366056) has the molecular formula C9H7N7O12 and a molecular weight of 405.19 g/mol. Its IUPAC name is 2,4,6-trinitro-N-(3,3,3-trinitropropyl)aniline.
| Compound Name | 2,4,6-trinitro-N-(3,3,3-trinitropropyl)aniline |
|---|---|
| PubChem CID | 71366056 |
| Molecular Formula | C9H7N7O12 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 2,4,6-trinitro-N-(3,3,3-trinitropropyl)aniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(NCCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H7N7O12/c17-11(18)5-3-6(12(19)20)8(7(4-5)13(21)22)10-2-1-9(14(23)24,15(25)26)16(27)28/h3-4,10H,1-2H2 |
| InChIKey | COGBUERKFLIJOW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 270.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|