C11H9N5O3S — CID 61014605
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine (PubChem CID 61014605) has the molecular formula C11H9N5O3S and a molecular weight of 291.29 g/mol. Its IUPAC name is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine.
| Compound Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 61014605 |
| Molecular Formula | C11H9N5O3S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine |
| SMILES | Cc1noc(CNc2ccc3scnc3c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H9N5O3S/c1-6-14-9(19-15-6)4-12-7-2-3-8-10(13-5-20-8)11(7)16(17)18/h2-3,5,12H,4H2,1H3 |
| InChIKey | DOQBDRMSFKAORX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|