C9H9N5O3 — CID 54903766
N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-nitropyridin-2-amine (PubChem CID 54903766) has the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. Its IUPAC name is N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-nitropyridin-2-amine.
| Compound Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 54903766 |
| Molecular Formula | C9H9N5O3 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-nitropyridin-2-amine |
| SMILES | Cc1noc(CNc2ncccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H9N5O3/c1-6-12-8(17-13-6)5-11-9-7(14(15)16)3-2-4-10-9/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | KACOPWFPVKQRRG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|