C11H10F2N4O3 — CID 63750445
2-(difluoromethyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitroaniline (PubChem CID 63750445) has the molecular formula C11H10F2N4O3 and a molecular weight of 284.22 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitroaniline.
| Compound Name | 2-(difluoromethyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 63750445 |
| Molecular Formula | C11H10F2N4O3 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-(difluoromethyl)-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-4-nitroaniline |
| SMILES | Cc1noc(CNc2ccc([N+](=O)[O-])cc2C(F)F)n1 |
| InChI | InChI=1S/C11H10F2N4O3/c1-6-15-10(20-16-6)5-14-9-3-2-7(17(18)19)4-8(9)11(12)13/h2-4,11,14H,5H2,1H3 |
| InChIKey | BJRJHDYCZSCINP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|