C12H13N3O3S — CID 43610403
4-nitro-N-(oxan-4-yl)-1,3-benzothiazol-5-amine (PubChem CID 43610403) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 4-nitro-N-(oxan-4-yl)-1,3-benzothiazol-5-amine.
| Compound Name | 4-nitro-N-(oxan-4-yl)-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 43610403 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-nitro-N-(oxan-4-yl)-1,3-benzothiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(NC2CCOCC2)ccc2scnc12 |
| InChI | InChI=1S/C12H13N3O3S/c16-15(17)12-9(14-8-3-5-18-6-4-8)1-2-10-11(12)13-7-19-10/h1-2,7-8,14H,3-6H2 |
| InChIKey | TVMXHHJBHULRBR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|