C13H13N3O4S — CID 106322169
cis-(1R,3S)-3-[(4-nitro-1,3-benzothiazol-5-yl)amino]cyclopentane-1-carboxylic acid (PubChem CID 106322169) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(4-nitro-1,3-benzothiazol-5-yl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[(4-nitro-1,3-benzothiazol-5-yl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106322169 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | cis-(1R,3S)-3-[(4-nitro-1,3-benzothiazol-5-yl)amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC[C@H](Nc2ccc3scnc3c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H13N3O4S/c17-13(18)7-1-2-8(5-7)15-9-3-4-10-11(14-6-21-10)12(9)16(19)20/h3-4,6-8,15H,1-2,5H2,(H,17,18)/t7-,8+/m1/s1 |
| InChIKey | VNMOHVUGXKTXCJ-SFYZADRCSA-N |
| XLogP | 2.87 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|