C14H14BrClN6S — CID 165394607
6-N-(5-bromo-2-chloropyrimidin-4-yl)-5-N-methylsulfanylquinoxaline-5,6-diamine;methane (PubChem CID 165394607) has the molecular formula C14H14BrClN6S and a molecular weight of 413.73 g/mol. Its IUPAC name is 6-N-(5-bromo-2-chloropyrimidin-4-yl)-5-N-methylsulfanylquinoxaline-5,6-diamine;methane.
| Compound Name | 6-N-(5-bromo-2-chloropyrimidin-4-yl)-5-N-methylsulfanylquinoxaline-5,6-diamine;methane |
|---|---|
| PubChem CID | 165394607 |
| Molecular Formula | C14H14BrClN6S |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 6-N-(5-bromo-2-chloropyrimidin-4-yl)-5-N-methylsulfanylquinoxaline-5,6-diamine;methane |
| SMILES | C.CSNc1c(Nc2nc(Cl)ncc2Br)ccc2nccnc12 |
| InChI | InChI=1S/C13H10BrClN6S.CH4/c1-22-21-11-9(3-2-8-10(11)17-5-4-16-8)19-12-7(14)6-18-13(15)20-12;/h2-6,21H,1H3,(H,18,19,20);1H4 |
| InChIKey | CHHGZUIERDMQDP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|