C15H13BrClN4P — CID 163980188
N-(5-bromo-2-chloropyrimidin-4-yl)-2-methyl-5-methylphosphanylquinolin-6-amine (PubChem CID 163980188) has the molecular formula C15H13BrClN4P and a molecular weight of 395.63 g/mol. Its IUPAC name is N-(5-bromo-2-chloropyrimidin-4-yl)-2-methyl-5-methylphosphanylquinolin-6-amine.
| Compound Name | N-(5-bromo-2-chloropyrimidin-4-yl)-2-methyl-5-methylphosphanylquinolin-6-amine |
|---|---|
| PubChem CID | 163980188 |
| Molecular Formula | C15H13BrClN4P |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | N-(5-bromo-2-chloropyrimidin-4-yl)-2-methyl-5-methylphosphanylquinolin-6-amine |
| SMILES | CPc1c(Nc2nc(Cl)ncc2Br)ccc2nc(C)ccc12 |
| InChI | InChI=1S/C15H13BrClN4P/c1-8-3-4-9-11(19-8)5-6-12(13(9)22-2)20-14-10(16)7-18-15(17)21-14/h3-7,22H,1-2H3,(H,18,20,21) |
| InChIKey | SXRPXIBVDSIKEU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|