C27H31ClN8OS — CID 165394459
6-N-[5-chloro-2-(4-piperidin-4-yl-2-propan-2-yloxyanilino)pyrimidin-4-yl]-5-N-methylsulfanylquinoxaline-5,6-diamine (PubChem CID 165394459) has the molecular formula C27H31ClN8OS and a molecular weight of 551.12 g/mol. Its IUPAC name is 6-N-[5-chloro-2-(4-piperidin-4-yl-2-propan-2-yloxyanilino)pyrimidin-4-yl]-5-N-methylsulfanylquinoxaline-5,6-diamine.
| Compound Name | 6-N-[5-chloro-2-(4-piperidin-4-yl-2-propan-2-yloxyanilino)pyrimidin-4-yl]-5-N-methylsulfanylquinoxaline-5,6-diamine |
|---|---|
| PubChem CID | 165394459 |
| Molecular Formula | C27H31ClN8OS |
| Molecular Weight | 551.12 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 6-N-[5-chloro-2-(4-piperidin-4-yl-2-propan-2-yloxyanilino)pyrimidin-4-yl]-5-N-methylsulfanylquinoxaline-5,6-diamine |
| SMILES | CSNc1c(Nc2nc(Nc3ccc(C4CCNCC4)cc3OC(C)C)ncc2Cl)ccc2nccnc12 |
| InChI | InChI=1S/C27H31ClN8OS/c1-16(2)37-23-14-18(17-8-10-29-11-9-17)4-5-20(23)34-27-32-15-19(28)26(35-27)33-22-7-6-21-24(25(22)36-38-3)31-13-12-30-21/h4-7,12-17,29,36H,8-11H2,1-3H3,(H2,32,33,34,35) |
| InChIKey | LKKXDWKRTFCMTP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.12 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|