C13H10ClN5 — CID 116797540
2-N-(5-chloroquinolin-8-yl)pyrimidine-2,4-diamine (PubChem CID 116797540) has the molecular formula C13H10ClN5 and a molecular weight of 271.71 g/mol. Its IUPAC name is 2-N-(5-chloroquinolin-8-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(5-chloroquinolin-8-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116797540 |
| Molecular Formula | C13H10ClN5 |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-N-(5-chloroquinolin-8-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1ccnc(Nc2ccc(Cl)c3cccnc23)n1 |
| InChI | InChI=1S/C13H10ClN5/c14-9-3-4-10(12-8(9)2-1-6-16-12)18-13-17-7-5-11(15)19-13/h1-7H,(H3,15,17,18,19) |
| InChIKey | SIUQFGYPAIIFGO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |