C13H9Cl2N5 — CID 116785193
6-chloro-4-N-(5-chloroquinolin-8-yl)pyrimidine-2,4-diamine (PubChem CID 116785193) has the molecular formula C13H9Cl2N5 and a molecular weight of 306.16 g/mol. Its IUPAC name is 6-chloro-4-N-(5-chloroquinolin-8-yl)pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(5-chloroquinolin-8-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116785193 |
| Molecular Formula | C13H9Cl2N5 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 6-chloro-4-N-(5-chloroquinolin-8-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(Nc2ccc(Cl)c3cccnc23)n1 |
| InChI | InChI=1S/C13H9Cl2N5/c14-8-3-4-9(12-7(8)2-1-5-17-12)18-11-6-10(15)19-13(16)20-11/h1-6H,(H3,16,18,19,20) |
| InChIKey | CGGAOXZBYDQALN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |