C12H9ClN4S — CID 102769112
2-N-(5-chloroquinolin-8-yl)-1,3-thiazole-2,5-diamine (PubChem CID 102769112) has the molecular formula C12H9ClN4S and a molecular weight of 276.75 g/mol. Its IUPAC name is 2-N-(5-chloroquinolin-8-yl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(5-chloroquinolin-8-yl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102769112 |
| Molecular Formula | C12H9ClN4S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-N-(5-chloroquinolin-8-yl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(Nc2ccc(Cl)c3cccnc23)s1 |
| InChI | InChI=1S/C12H9ClN4S/c13-8-3-4-9(11-7(8)2-1-5-15-11)17-12-16-6-10(14)18-12/h1-6H,14H2,(H,16,17) |
| InChIKey | DSYDWYSKKPRBSA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |