C13H11ClN6 — CID 116785810
4-N-(5-chloroquinolin-8-yl)pyrimidine-2,4,6-triamine (PubChem CID 116785810) has the molecular formula C13H11ClN6 and a molecular weight of 286.73 g/mol. Its IUPAC name is 4-N-(5-chloroquinolin-8-yl)pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(5-chloroquinolin-8-yl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 116785810 |
| Molecular Formula | C13H11ClN6 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 4-N-(5-chloroquinolin-8-yl)pyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(Nc2ccc(Cl)c3cccnc23)nc(N)n1 |
| InChI | InChI=1S/C13H11ClN6/c14-8-3-4-9(12-7(8)2-1-5-17-12)18-11-6-10(15)19-13(16)20-11/h1-6H,(H5,15,16,18,19,20) |
| InChIKey | FZWJDWNHDIRTLG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |