C10H5Cl3IN3 — CID 165395228
2,5-dichloro-N-(5-chloro-2-iodophenyl)pyrimidin-4-amine (PubChem CID 165395228) has the molecular formula C10H5Cl3IN3 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2,5-dichloro-N-(5-chloro-2-iodophenyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(5-chloro-2-iodophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 165395228 |
| Molecular Formula | C10H5Cl3IN3 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 398.86 |
| IUPAC Name | 2,5-dichloro-N-(5-chloro-2-iodophenyl)pyrimidin-4-amine |
| SMILES | Clc1ccc(I)c(Nc2nc(Cl)ncc2Cl)c1 |
| InChI | InChI=1S/C10H5Cl3IN3/c11-5-1-2-7(14)8(3-5)16-9-6(12)4-15-10(13)17-9/h1-4H,(H,15,16,17) |
| InChIKey | QELBTVGQXOZGEY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|