C10H6Cl2IN3 — CID 66340125
N-(2,4-dichlorophenyl)-5-iodopyrimidin-4-amine (PubChem CID 66340125) has the molecular formula C10H6Cl2IN3 and a molecular weight of 365.99 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-5-iodopyrimidin-4-amine.
| Compound Name | N-(2,4-dichlorophenyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66340125 |
| Molecular Formula | C10H6Cl2IN3 |
| Molecular Weight | 365.99 g/mol |
| Exact Mass | 364.90 |
| IUPAC Name | N-(2,4-dichlorophenyl)-5-iodopyrimidin-4-amine |
| SMILES | Clc1ccc(Nc2ncncc2I)c(Cl)c1 |
| InChI | InChI=1S/C10H6Cl2IN3/c11-6-1-2-9(7(12)3-6)16-10-8(13)4-14-5-15-10/h1-5H,(H,14,15,16) |
| InChIKey | NQAFOWGCJKBSJM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.99 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|