C10H7Cl3N4 — CID 80759585
5-chloro-4-N-(2,4-dichlorophenyl)pyrimidine-2,4-diamine (PubChem CID 80759585) has the molecular formula C10H7Cl3N4 and a molecular weight of 289.55 g/mol. Its IUPAC name is 5-chloro-4-N-(2,4-dichlorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2,4-dichlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80759585 |
| Molecular Formula | C10H7Cl3N4 |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | 5-chloro-4-N-(2,4-dichlorophenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(Cl)c(Nc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H7Cl3N4/c11-5-1-2-8(6(12)3-5)16-9-7(13)4-15-10(14)17-9/h1-4H,(H3,14,15,16,17) |
| InChIKey | JTBAIDKZECBBTG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |