C11H10Cl2N4 — CID 80755519
5-chloro-4-N-(2-chloro-4-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 80755519) has the molecular formula C11H10Cl2N4 and a molecular weight of 269.14 g/mol. Its IUPAC name is 5-chloro-4-N-(2-chloro-4-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-chloro-4-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80755519 |
| Molecular Formula | C11H10Cl2N4 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-chloro-4-N-(2-chloro-4-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N)ncc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N4/c1-6-2-3-9(7(12)4-6)16-10-8(13)5-15-11(14)17-10/h2-5H,1H3,(H3,14,15,16,17) |
| InChIKey | OPOLGZLQWRIAEZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |