C12H7Cl2FN4 — CID 175424569
N-(2,5-dichloropyrimidin-4-yl)-4-fluoro-1H-indol-7-amine (PubChem CID 175424569) has the molecular formula C12H7Cl2FN4 and a molecular weight of 297.12 g/mol. Its IUPAC name is N-(2,5-dichloropyrimidin-4-yl)-4-fluoro-1H-indol-7-amine.
| Compound Name | N-(2,5-dichloropyrimidin-4-yl)-4-fluoro-1H-indol-7-amine |
|---|---|
| PubChem CID | 175424569 |
| Molecular Formula | C12H7Cl2FN4 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | N-(2,5-dichloropyrimidin-4-yl)-4-fluoro-1H-indol-7-amine |
| SMILES | Fc1ccc(Nc2nc(Cl)ncc2Cl)c2[nH]ccc12 |
| InChI | InChI=1S/C12H7Cl2FN4/c13-7-5-17-12(14)19-11(7)18-9-2-1-8(15)6-3-4-16-10(6)9/h1-5,16H,(H,17,18,19) |
| InChIKey | BRJUCYPRYJDLQP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |